C12H11N3O8 — CID 87544882
[(E)-3-methoxy-1-(3-methyl-4,5-dinitrophenyl)-3-oxoprop-1-en-2-yl]carbamic acid (PubChem CID 87544882) has the molecular formula C12H11N3O8 and a molecular weight of 325.23 g/mol. Its IUPAC name is [(E)-3-methoxy-1-(3-methyl-4,5-dinitrophenyl)-3-oxoprop-1-en-2-yl]carbamic acid.
| Compound Name | [(E)-3-methoxy-1-(3-methyl-4,5-dinitrophenyl)-3-oxoprop-1-en-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87544882 |
| Molecular Formula | C12H11N3O8 |
| Molecular Weight | 325.23 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | [(E)-3-methoxy-1-(3-methyl-4,5-dinitrophenyl)-3-oxoprop-1-en-2-yl]carbamic acid |
| SMILES | COC(=O)/C(=C\c1cc(C)c([N+](=O)[O-])c([N+](=O)[O-])c1)NC(=O)O |
| InChI | InChI=1S/C12H11N3O8/c1-6-3-7(4-8(11(16)23-2)13-12(17)18)5-9(14(19)20)10(6)15(21)22/h3-5,13H,1-2H3,(H,17,18)/b8-4+ |
| InChIKey | QFMUGGACQVRULD-XBXARRHUSA-N |
| XLogP | 1.59 |
| TPSA | 161.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|