C14H12ClF3N8O2 — CID 87544892
4-[2-[[7-chloro-2-(trifluoromethyl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]-3-nitropyridine-2,6-diamine (PubChem CID 87544892) has the molecular formula C14H12ClF3N8O2 and a molecular weight of 416.75 g/mol. Its IUPAC name is 4-[2-[[7-chloro-2-(trifluoromethyl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]-3-nitropyridine-2,6-diamine.
| Compound Name | 4-[2-[[7-chloro-2-(trifluoromethyl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 87544892 |
| Molecular Formula | C14H12ClF3N8O2 |
| Molecular Weight | 416.75 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 4-[2-[[7-chloro-2-(trifluoromethyl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]-3-nitropyridine-2,6-diamine |
| SMILES | Nc1cc(CCNc2nc(Cl)cc3nc(C(F)(F)F)cn23)c([N+](=O)[O-])c(N)n1 |
| InChI | InChI=1S/C14H12ClF3N8O2/c15-8-4-10-22-7(14(16,17)18)5-25(10)13(23-8)21-2-1-6-3-9(19)24-12(20)11(6)26(27)28/h3-5H,1-2H2,(H,21,23)(H4,19,20,24) |
| InChIKey | VCQKCJSHEFSOQT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 150.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.75 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|