C13H9F3N6OS — CID 87545305
2-[4-[4-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]phenyl]-1,3-thiazol-2-yl]guanidine (PubChem CID 87545305) has the molecular formula C13H9F3N6OS and a molecular weight of 354.32 g/mol. Its IUPAC name is 2-[4-[4-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]phenyl]-1,3-thiazol-2-yl]guanidine.
| Compound Name | 2-[4-[4-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]phenyl]-1,3-thiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 87545305 |
| Molecular Formula | C13H9F3N6OS |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 2-[4-[4-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]phenyl]-1,3-thiazol-2-yl]guanidine |
| SMILES | NC(N)=Nc1nc(-c2ccc(-c3nc(C(F)(F)F)no3)cc2)cs1 |
| InChI | InChI=1S/C13H9F3N6OS/c14-13(15,16)10-20-9(23-22-10)7-3-1-6(2-4-7)8-5-24-12(19-8)21-11(17)18/h1-5H,(H4,17,18,19,21) |
| InChIKey | JTYIEJMDCMDCRP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|