C14H12Cl2N2O3 — CID 87545488
3-cyclopropyl-5-(2,4-dichloro-5-hydroxyphenoxy)-1-methylpyrazole-4-carbaldehyde (PubChem CID 87545488) has the molecular formula C14H12Cl2N2O3 and a molecular weight of 327.17 g/mol. Its IUPAC name is 3-cyclopropyl-5-(2,4-dichloro-5-hydroxyphenoxy)-1-methylpyrazole-4-carbaldehyde.
| Compound Name | 3-cyclopropyl-5-(2,4-dichloro-5-hydroxyphenoxy)-1-methylpyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 87545488 |
| Molecular Formula | C14H12Cl2N2O3 |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 3-cyclopropyl-5-(2,4-dichloro-5-hydroxyphenoxy)-1-methylpyrazole-4-carbaldehyde |
| SMILES | Cn1nc(C2CC2)c(C=O)c1Oc1cc(O)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H12Cl2N2O3/c1-18-14(8(6-19)13(17-18)7-2-3-7)21-12-5-11(20)9(15)4-10(12)16/h4-7,20H,2-3H2,1H3 |
| InChIKey | KIWYTCJWZNYYPU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|