C32H43N3O6 — CID 87545540
[4-[[2-hexanoyl-7-[(2-methylpropan-2-yl)oxycarbonylamino]-3,4-dihydro-1H-isoquinoline-1-carbonyl]amino]-2,3,6-trimethylphenyl] acetate (PubChem CID 87545540) has the molecular formula C32H43N3O6 and a molecular weight of 565.71 g/mol. Its IUPAC name is [4-[[2-hexanoyl-7-[(2-methylpropan-2-yl)oxycarbonylamino]-3,4-dihydro-1H-isoquinoline-1-carbonyl]amino]-2,3,6-trimethylphenyl] acetate.
| Compound Name | [4-[[2-hexanoyl-7-[(2-methylpropan-2-yl)oxycarbonylamino]-3,4-dihydro-1H-isoquinoline-1-carbonyl]amino]-2,3,6-trimethylphenyl] acetate |
|---|---|
| PubChem CID | 87545540 |
| Molecular Formula | C32H43N3O6 |
| Molecular Weight | 565.71 g/mol |
| Exact Mass | 565.32 |
| IUPAC Name | [4-[[2-hexanoyl-7-[(2-methylpropan-2-yl)oxycarbonylamino]-3,4-dihydro-1H-isoquinoline-1-carbonyl]amino]-2,3,6-trimethylphenyl] acetate |
| SMILES | CCCCCC(=O)N1CCc2ccc(NC(=O)OC(C)(C)C)cc2C1C(=O)Nc1cc(C)c(OC(C)=O)c(C)c1C |
| InChI | InChI=1S/C32H43N3O6/c1-9-10-11-12-27(37)35-16-15-23-13-14-24(33-31(39)41-32(6,7)8)18-25(23)28(35)30(38)34-26-17-19(2)29(40-22(5)36)21(4)20(26)3/h13-14,17-18,28H,9-12,15-16H2,1-8H3,(H,33,39)(H,34,38) |
| InChIKey | JEZMBELLIGFULC-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.71 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|