C23H29N3O3 — CID 87545965
[4-[[7-(dimethylamino)-1,2,3,4-tetrahydroisoquinoline-1-carbonyl]amino]-2,3,6-trimethylphenyl] acetate (PubChem CID 87545965) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is [4-[[7-(dimethylamino)-1,2,3,4-tetrahydroisoquinoline-1-carbonyl]amino]-2,3,6-trimethylphenyl] acetate.
| Compound Name | [4-[[7-(dimethylamino)-1,2,3,4-tetrahydroisoquinoline-1-carbonyl]amino]-2,3,6-trimethylphenyl] acetate |
|---|---|
| PubChem CID | 87545965 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | [4-[[7-(dimethylamino)-1,2,3,4-tetrahydroisoquinoline-1-carbonyl]amino]-2,3,6-trimethylphenyl] acetate |
| SMILES | CC(=O)Oc1c(C)cc(NC(=O)C2NCCc3ccc(N(C)C)cc32)c(C)c1C |
| InChI | InChI=1S/C23H29N3O3/c1-13-11-20(14(2)15(3)22(13)29-16(4)27)25-23(28)21-19-12-18(26(5)6)8-7-17(19)9-10-24-21/h7-8,11-12,21,24H,9-10H2,1-6H3,(H,25,28) |
| InChIKey | NTSSABOWKPYKQH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|