C11H9F6N5O — CID 87546177
4-(2,2,3,4,4,4-hexafluorobutoxy)-2-methyl-6-(1,2,4-triazol-1-yl)pyrimidine (PubChem CID 87546177) has the molecular formula C11H9F6N5O and a molecular weight of 341.22 g/mol. Its IUPAC name is 4-(2,2,3,4,4,4-hexafluorobutoxy)-2-methyl-6-(1,2,4-triazol-1-yl)pyrimidine.
| Compound Name | 4-(2,2,3,4,4,4-hexafluorobutoxy)-2-methyl-6-(1,2,4-triazol-1-yl)pyrimidine |
|---|---|
| PubChem CID | 87546177 |
| Molecular Formula | C11H9F6N5O |
| Molecular Weight | 341.22 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 4-(2,2,3,4,4,4-hexafluorobutoxy)-2-methyl-6-(1,2,4-triazol-1-yl)pyrimidine |
| SMILES | Cc1nc(OCC(F)(F)C(F)C(F)(F)F)cc(-n2cncn2)n1 |
| InChI | InChI=1S/C11H9F6N5O/c1-6-20-7(22-5-18-4-19-22)2-8(21-6)23-3-10(13,14)9(12)11(15,16)17/h2,4-5,9H,3H2,1H3 |
| InChIKey | OWTGMTBCYAWJOW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |