C18H18ClF3N4O5S2 — CID 87546273
[(3-chloro-2-methylphenyl)sulfonyl-[4-(2-oxo-2-piperazin-1-ylethyl)-1,3-thiazol-2-yl]amino] 2,2,2-trifluoroacetate (PubChem CID 87546273) has the molecular formula C18H18ClF3N4O5S2 and a molecular weight of 526.95 g/mol. Its IUPAC name is [(3-chloro-2-methylphenyl)sulfonyl-[4-(2-oxo-2-piperazin-1-ylethyl)-1,3-thiazol-2-yl]amino] 2,2,2-trifluoroacetate.
| Compound Name | [(3-chloro-2-methylphenyl)sulfonyl-[4-(2-oxo-2-piperazin-1-ylethyl)-1,3-thiazol-2-yl]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87546273 |
| Molecular Formula | C18H18ClF3N4O5S2 |
| Molecular Weight | 526.95 g/mol |
| Exact Mass | 526.04 |
| IUPAC Name | [(3-chloro-2-methylphenyl)sulfonyl-[4-(2-oxo-2-piperazin-1-ylethyl)-1,3-thiazol-2-yl]amino] 2,2,2-trifluoroacetate |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)N(OC(=O)C(F)(F)F)c1nc(CC(=O)N2CCNCC2)cs1 |
| InChI | InChI=1S/C18H18ClF3N4O5S2/c1-11-13(19)3-2-4-14(11)33(29,30)26(31-16(28)18(20,21)22)17-24-12(10-32-17)9-15(27)25-7-5-23-6-8-25/h2-4,10,23H,5-9H2,1H3 |
| InChIKey | MZJWQJQAPDWZIP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.95 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|