C12H9F8N5O — CID 87546444
5-methyl-4-(2,2,3,3,4,4,5,5-octafluoropentoxy)-6-(1,2,4-triazol-1-yl)pyrimidine (PubChem CID 87546444) has the molecular formula C12H9F8N5O and a molecular weight of 391.22 g/mol. Its IUPAC name is 5-methyl-4-(2,2,3,3,4,4,5,5-octafluoropentoxy)-6-(1,2,4-triazol-1-yl)pyrimidine.
| Compound Name | 5-methyl-4-(2,2,3,3,4,4,5,5-octafluoropentoxy)-6-(1,2,4-triazol-1-yl)pyrimidine |
|---|---|
| PubChem CID | 87546444 |
| Molecular Formula | C12H9F8N5O |
| Molecular Weight | 391.22 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 5-methyl-4-(2,2,3,3,4,4,5,5-octafluoropentoxy)-6-(1,2,4-triazol-1-yl)pyrimidine |
| SMILES | Cc1c(OCC(F)(F)C(F)(F)C(F)(F)C(F)F)ncnc1-n1cncn1 |
| InChI | InChI=1S/C12H9F8N5O/c1-6-7(25-5-21-3-24-25)22-4-23-8(6)26-2-10(15,16)12(19,20)11(17,18)9(13)14/h3-5,9H,2H2,1H3 |
| InChIKey | JJZORDMPABIJEA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|