About 1-chloroethane-1,2-disulfonyl chloride
1-chloroethane-1,2-disulfonyl chloride (PubChem CID 87546755) has the molecular formula C2H3Cl3O4S2
and a molecular weight of 261.54 g/mol. Its IUPAC name is 1-chloroethane-1,2-disulfonyl chloride.
Molecular Properties
| Compound Name | 1-chloroethane-1,2-disulfonyl chloride |
| PubChem CID | 87546755 |
| Molecular Formula | C2H3Cl3O4S2 |
| Molecular Weight | 261.54 g/mol |
| Exact Mass | 259.85 |
| IUPAC Name | 1-chloroethane-1,2-disulfonyl chloride |
| SMILES | O=S(=O)(Cl)CC(Cl)S(=O)(=O)Cl |
| InChI | InChI=1S/C2H3Cl3O4S2/c3-2(11(5,8)9)1-10(4,6)7/h2H,1H2 |
| InChIKey | XWHCZJXHKJQMDJ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.54 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloroethane-1,2-disulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloroethane-1,2-disulfonyl chloride?
The IUPAC name of 1-chloroethane-1,2-disulfonyl chloride (CID 87546755) is 1-chloroethane-1,2-disulfonyl chloride.
What is the SMILES notation for 1-chloroethane-1,2-disulfonyl chloride?
The canonical SMILES for 1-chloroethane-1,2-disulfonyl chloride is O=S(=O)(Cl)CC(Cl)S(=O)(=O)Cl.
What is the InChIKey of 1-chloroethane-1,2-disulfonyl chloride?
The InChIKey is XWHCZJXHKJQMDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3Cl3O4S2/c3-2(11(5,8)9)1-10(4,6)7/h2H,1H2.
What are the key properties of 1-chloroethane-1,2-disulfonyl chloride?
1-chloroethane-1,2-disulfonyl chloride has a molecular weight of 261.54 g/mol, XLogP of 0.69, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloroethane-1,2-disulfonyl chloride is sourced from PubChem (CID 87546755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).