About chloro-(1,1-dibromo-3-hydroxy-2,2-dimethylpropoxy)phosphinic acid
chloro-(1,1-dibromo-3-hydroxy-2,2-dimethylpropoxy)phosphinic acid (PubChem CID 87546822) has the molecular formula C5H10Br2ClO4P
and a molecular weight of 360.37 g/mol. Its IUPAC name is chloro-(1,1-dibromo-3-hydroxy-2,2-dimethylpropoxy)phosphinic acid.
Molecular Properties
| Compound Name | chloro-(1,1-dibromo-3-hydroxy-2,2-dimethylpropoxy)phosphinic acid |
| PubChem CID | 87546822 |
| Molecular Formula | C5H10Br2ClO4P |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 357.84 |
| IUPAC Name | chloro-(1,1-dibromo-3-hydroxy-2,2-dimethylpropoxy)phosphinic acid |
| SMILES | CC(C)(CO)C(Br)(Br)OP(=O)(O)Cl |
| InChI | InChI=1S/C5H10Br2ClO4P/c1-4(2,3-9)5(6,7)12-13(8,10)11/h9H,3H2,1-2H3,(H,10,11) |
| InChIKey | PJGNEVOZXOFHRA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chloro-(1,1-dibromo-3-hydroxy-2,2-dimethylpropoxy)phosphinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-(1,1-dibromo-3-hydroxy-2,2-dimethylpropoxy)phosphinic acid?
The IUPAC name of chloro-(1,1-dibromo-3-hydroxy-2,2-dimethylpropoxy)phosphinic acid (CID 87546822) is chloro-(1,1-dibromo-3-hydroxy-2,2-dimethylpropoxy)phosphinic acid.
What is the SMILES notation for chloro-(1,1-dibromo-3-hydroxy-2,2-dimethylpropoxy)phosphinic acid?
The canonical SMILES for chloro-(1,1-dibromo-3-hydroxy-2,2-dimethylpropoxy)phosphinic acid is CC(C)(CO)C(Br)(Br)OP(=O)(O)Cl.
What is the InChIKey of chloro-(1,1-dibromo-3-hydroxy-2,2-dimethylpropoxy)phosphinic acid?
The InChIKey is PJGNEVOZXOFHRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10Br2ClO4P/c1-4(2,3-9)5(6,7)12-13(8,10)11/h9H,3H2,1-2H3,(H,10,11).
What are the key properties of chloro-(1,1-dibromo-3-hydroxy-2,2-dimethylpropoxy)phosphinic acid?
chloro-(1,1-dibromo-3-hydroxy-2,2-dimethylpropoxy)phosphinic acid has a molecular weight of 360.37 g/mol, XLogP of 2.80, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-(1,1-dibromo-3-hydroxy-2,2-dimethylpropoxy)phosphinic acid is sourced from PubChem (CID 87546822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).