C32H36F6N6O4 — CID 87546883
ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(4-hydroxypiperidin-1-yl)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate (PubChem CID 87546883) has the molecular formula C32H36F6N6O4 and a molecular weight of 682.67 g/mol. Its IUPAC name is ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(4-hydroxypiperidin-1-yl)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate.
| Compound Name | ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(4-hydroxypiperidin-1-yl)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 87546883 |
| Molecular Formula | C32H36F6N6O4 |
| Molecular Weight | 682.67 g/mol |
| Exact Mass | 682.27 |
| IUPAC Name | ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(4-hydroxypiperidin-1-yl)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
| SMILES | CCOC(=O)N1c2ccc(OC)nc2[C@@H](Nc2ncc(N3CCC(O)CC3)c(Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)C[C@H]1CC |
| InChI | InChI=1S/C32H36F6N6O4/c1-4-21-16-24(28-25(6-7-27(42-28)47-3)44(21)30(46)48-5-2)41-29-39-17-26(43-10-8-22(45)9-11-43)23(40-29)14-18-12-19(31(33,34)35)15-20(13-18)32(36,37)38/h6-7,12-13,15,17,21-22,24,45H,4-5,8-11,14,16H2,1-3H3,(H,39,40,41)/t21-,24+/m1/s1 |
| InChIKey | NHHDJSHTVJTLKR-QPPBQGQZSA-N |
| XLogP | 6.77 |
| TPSA | 112.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.67 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |