About 1-aminoethyl decanoate
1-aminoethyl decanoate (PubChem CID 87547112) has the molecular formula C12H25NO2
and a molecular weight of 215.34 g/mol. Its IUPAC name is 1-aminoethyl decanoate.
Molecular Properties
| Compound Name | 1-aminoethyl decanoate |
| PubChem CID | 87547112 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 1-aminoethyl decanoate |
| SMILES | CCCCCCCCCC(=O)OC(C)N |
| InChI | InChI=1S/C12H25NO2/c1-3-4-5-6-7-8-9-10-12(14)15-11(2)13/h11H,3-10,13H2,1-2H3 |
| InChIKey | HEXMGBFIVHALMT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-aminoethyl decanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoethyl decanoate?
The IUPAC name of 1-aminoethyl decanoate (CID 87547112) is 1-aminoethyl decanoate.
What is the SMILES notation for 1-aminoethyl decanoate?
The canonical SMILES for 1-aminoethyl decanoate is CCCCCCCCCC(=O)OC(C)N.
What is the InChIKey of 1-aminoethyl decanoate?
The InChIKey is HEXMGBFIVHALMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO2/c1-3-4-5-6-7-8-9-10-12(14)15-11(2)13/h11H,3-10,13H2,1-2H3.
What are the key properties of 1-aminoethyl decanoate?
1-aminoethyl decanoate has a molecular weight of 215.34 g/mol, XLogP of 2.97, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoethyl decanoate is sourced from PubChem (CID 87547112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).