C34H34F6N6O4 — CID 87547283
ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-pyridin-2-ylethoxy)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate (PubChem CID 87547283) has the molecular formula C34H34F6N6O4 and a molecular weight of 704.67 g/mol. Its IUPAC name is ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-pyridin-2-ylethoxy)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate.
| Compound Name | ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-pyridin-2-ylethoxy)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 87547283 |
| Molecular Formula | C34H34F6N6O4 |
| Molecular Weight | 704.67 g/mol |
| Exact Mass | 704.25 |
| IUPAC Name | ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-pyridin-2-ylethoxy)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
| SMILES | CCOC(=O)N1c2ccc(OC)nc2[C@@H](Nc2ncc(OCCc3ccccn3)c(Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)C[C@H]1CC |
| InChI | InChI=1S/C34H34F6N6O4/c1-4-24-18-26(30-27(9-10-29(45-30)48-3)46(24)32(47)49-5-2)44-31-42-19-28(50-13-11-23-8-6-7-12-41-23)25(43-31)16-20-14-21(33(35,36)37)17-22(15-20)34(38,39)40/h6-10,12,14-15,17,19,24,26H,4-5,11,13,16,18H2,1-3H3,(H,42,43,44)/t24-,26+/m1/s1 |
| InChIKey | HOIZABOKPVZPFP-RSXGOPAZSA-N |
| XLogP | 7.82 |
| TPSA | 111.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.67 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |