C10H9F4N5O — CID 87547325
5-methyl-4-(2,2,3,3-tetrafluoropropoxy)-6-(1,2,4-triazol-1-yl)pyrimidine (PubChem CID 87547325) has the molecular formula C10H9F4N5O and a molecular weight of 291.21 g/mol. Its IUPAC name is 5-methyl-4-(2,2,3,3-tetrafluoropropoxy)-6-(1,2,4-triazol-1-yl)pyrimidine.
| Compound Name | 5-methyl-4-(2,2,3,3-tetrafluoropropoxy)-6-(1,2,4-triazol-1-yl)pyrimidine |
|---|---|
| PubChem CID | 87547325 |
| Molecular Formula | C10H9F4N5O |
| Molecular Weight | 291.21 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 5-methyl-4-(2,2,3,3-tetrafluoropropoxy)-6-(1,2,4-triazol-1-yl)pyrimidine |
| SMILES | Cc1c(OCC(F)(F)C(F)F)ncnc1-n1cncn1 |
| InChI | InChI=1S/C10H9F4N5O/c1-6-7(19-5-15-3-18-19)16-4-17-8(6)20-2-10(13,14)9(11)12/h3-5,9H,2H2,1H3 |
| InChIKey | CZXJBJZLDDIETE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.21 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|