C9H7F4N5O — CID 87547368
4-(2,2,3,3-tetrafluoropropoxy)-6-(1,2,4-triazol-1-yl)pyrimidine (PubChem CID 87547368) has the molecular formula C9H7F4N5O and a molecular weight of 277.18 g/mol. Its IUPAC name is 4-(2,2,3,3-tetrafluoropropoxy)-6-(1,2,4-triazol-1-yl)pyrimidine.
| Compound Name | 4-(2,2,3,3-tetrafluoropropoxy)-6-(1,2,4-triazol-1-yl)pyrimidine |
|---|---|
| PubChem CID | 87547368 |
| Molecular Formula | C9H7F4N5O |
| Molecular Weight | 277.18 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 4-(2,2,3,3-tetrafluoropropoxy)-6-(1,2,4-triazol-1-yl)pyrimidine |
| SMILES | FC(F)C(F)(F)COc1cc(-n2cncn2)ncn1 |
| InChI | InChI=1S/C9H7F4N5O/c10-8(11)9(12,13)2-19-7-1-6(15-4-16-7)18-5-14-3-17-18/h1,3-5,8H,2H2 |
| InChIKey | JBCPBMQTAHJAJS-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.18 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|