About CID 87547372
CID 87547372 (PubChem CID 87547372) has the molecular formula C18H11Cl2Se+
and a molecular weight of 377.15 g/mol.
Molecular Properties
| Compound Name | CID 87547372 |
| PubChem CID | 87547372 |
| Molecular Formula | C18H11Cl2Se+ |
| Molecular Weight | 377.15 g/mol |
| Exact Mass | 376.94 |
| IUPAC Name | — |
| SMILES | Clc1ccccc1-c1cccc([Se+])c1-c1ccccc1Cl |
| InChI | InChI=1S/C18H11Cl2Se/c19-15-9-3-1-6-12(15)13-8-5-11-17(21)18(13)14-7-2-4-10-16(14)20/h1-11H/q+1 |
| InChIKey | HHFDSGAUFVBSAV-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.15 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87547372 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87547372?
The IUPAC name of CID 87547372 (CID 87547372) is not available.
What is the SMILES notation for CID 87547372?
The canonical SMILES for CID 87547372 is Clc1ccccc1-c1cccc([Se+])c1-c1ccccc1Cl.
What is the InChIKey of CID 87547372?
The InChIKey is HHFDSGAUFVBSAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11Cl2Se/c19-15-9-3-1-6-12(15)13-8-5-11-17(21)18(13)14-7-2-4-10-16(14)20/h1-11H/q+1.
What are the key properties of CID 87547372?
CID 87547372 has a molecular weight of 377.15 g/mol, XLogP of 5.12, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87547372 is sourced from PubChem (CID 87547372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).