C13H18FN4O3+ — CID 87547410
1-tert-butyl-1-(5-fluoropyrimidin-2-yl)-3-methyl-2-oxoimidazolidin-1-ium-4-carboxylic acid (PubChem CID 87547410) has the molecular formula C13H18FN4O3+ and a molecular weight of 297.31 g/mol. Its IUPAC name is 1-tert-butyl-1-(5-fluoropyrimidin-2-yl)-3-methyl-2-oxoimidazolidin-1-ium-4-carboxylic acid.
| Compound Name | 1-tert-butyl-1-(5-fluoropyrimidin-2-yl)-3-methyl-2-oxoimidazolidin-1-ium-4-carboxylic acid |
|---|---|
| PubChem CID | 87547410 |
| Molecular Formula | C13H18FN4O3+ |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 1-tert-butyl-1-(5-fluoropyrimidin-2-yl)-3-methyl-2-oxoimidazolidin-1-ium-4-carboxylic acid |
| SMILES | CN1C(=O)[N+](c2ncc(F)cn2)(C(C)(C)C)CC1C(=O)O |
| InChI | InChI=1S/C13H17FN4O3/c1-13(2,3)18(11-15-5-8(14)6-16-11)7-9(10(19)20)17(4)12(18)21/h5-6,9H,7H2,1-4H3/p+1 |
| InChIKey | FTXXCWUJWNPABP-UHFFFAOYSA-O |
| XLogP | 1.24 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|