About 2-(tributyl-λ5-phosphanylidene)propanedioic acid
2-(tributyl-λ5-phosphanylidene)propanedioic acid (PubChem CID 87547445) has the molecular formula C15H29O4P
and a molecular weight of 304.37 g/mol. Its IUPAC name is 2-(tributyl-λ5-phosphanylidene)propanedioic acid.
Molecular Properties
| Compound Name | 2-(tributyl-λ5-phosphanylidene)propanedioic acid |
| PubChem CID | 87547445 |
| Molecular Formula | C15H29O4P |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 2-(tributyl-λ5-phosphanylidene)propanedioic acid |
| SMILES | CCCCP(CCCC)(CCCC)=C(C(=O)O)C(=O)O |
| InChI | InChI=1S/C15H29O4P/c1-4-7-10-20(11-8-5-2,12-9-6-3)13(14(16)17)15(18)19/h4-12H2,1-3H3,(H,16,17)(H,18,19) |
| InChIKey | JHPFSQZQCGATEM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(tributyl-λ5-phosphanylidene)propanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(tributyl-λ5-phosphanylidene)propanedioic acid?
The IUPAC name of 2-(tributyl-λ5-phosphanylidene)propanedioic acid (CID 87547445) is 2-(tributyl-λ5-phosphanylidene)propanedioic acid.
What is the SMILES notation for 2-(tributyl-λ5-phosphanylidene)propanedioic acid?
The canonical SMILES for 2-(tributyl-λ5-phosphanylidene)propanedioic acid is CCCCP(CCCC)(CCCC)=C(C(=O)O)C(=O)O.
What is the InChIKey of 2-(tributyl-λ5-phosphanylidene)propanedioic acid?
The InChIKey is JHPFSQZQCGATEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29O4P/c1-4-7-10-20(11-8-5-2,12-9-6-3)13(14(16)17)15(18)19/h4-12H2,1-3H3,(H,16,17)(H,18,19).
What are the key properties of 2-(tributyl-λ5-phosphanylidene)propanedioic acid?
2-(tributyl-λ5-phosphanylidene)propanedioic acid has a molecular weight of 304.37 g/mol, XLogP of 3.75, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(tributyl-λ5-phosphanylidene)propanedioic acid is sourced from PubChem (CID 87547445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).