C17H28S8 — CID 87547576
1,9-bis(sulfanyl)-5,5-bis(4-sulfanyl-2-sulfanylidenebutyl)nonane-3,7-dithione (PubChem CID 87547576) has the molecular formula C17H28S8 and a molecular weight of 488.95 g/mol. Its IUPAC name is 1,9-bis(sulfanyl)-5,5-bis(4-sulfanyl-2-sulfanylidenebutyl)nonane-3,7-dithione.
| Compound Name | 1,9-bis(sulfanyl)-5,5-bis(4-sulfanyl-2-sulfanylidenebutyl)nonane-3,7-dithione |
|---|---|
| PubChem CID | 87547576 |
| Molecular Formula | C17H28S8 |
| Molecular Weight | 488.95 g/mol |
| Exact Mass | 488.00 |
| IUPAC Name | 1,9-bis(sulfanyl)-5,5-bis(4-sulfanyl-2-sulfanylidenebutyl)nonane-3,7-dithione |
| SMILES | S=C(CCS)CC(CC(=S)CCS)(CC(=S)CCS)CC(=S)CCS |
| InChI | InChI=1S/C17H28S8/c18-5-1-13(22)9-17(10-14(23)2-6-19,11-15(24)3-7-20)12-16(25)4-8-21/h18-21H,1-12H2 |
| InChIKey | ZQVQRZUSBCZOKD-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.95 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|