C13H13F6N5O — CID 87547690
4-(2,2,3,4,4,4-hexafluorobutoxy)-5-propan-2-yl-6-(1,2,4-triazol-1-yl)pyrimidine (PubChem CID 87547690) has the molecular formula C13H13F6N5O and a molecular weight of 369.27 g/mol. Its IUPAC name is 4-(2,2,3,4,4,4-hexafluorobutoxy)-5-propan-2-yl-6-(1,2,4-triazol-1-yl)pyrimidine.
| Compound Name | 4-(2,2,3,4,4,4-hexafluorobutoxy)-5-propan-2-yl-6-(1,2,4-triazol-1-yl)pyrimidine |
|---|---|
| PubChem CID | 87547690 |
| Molecular Formula | C13H13F6N5O |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 4-(2,2,3,4,4,4-hexafluorobutoxy)-5-propan-2-yl-6-(1,2,4-triazol-1-yl)pyrimidine |
| SMILES | CC(C)c1c(OCC(F)(F)C(F)C(F)(F)F)ncnc1-n1cncn1 |
| InChI | InChI=1S/C13H13F6N5O/c1-7(2)8-9(24-6-20-4-23-24)21-5-22-10(8)25-3-12(15,16)11(14)13(17,18)19/h4-7,11H,3H2,1-2H3 |
| InChIKey | UAZGIVBPBLGVHD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |