C10H8F6N6O — CID 87547698
4-(2,2,3,4,4,4-hexafluorobutoxy)-6-(1,2,4-triazol-1-yl)pyrimidin-2-amine (PubChem CID 87547698) has the molecular formula C10H8F6N6O and a molecular weight of 342.20 g/mol. Its IUPAC name is 4-(2,2,3,4,4,4-hexafluorobutoxy)-6-(1,2,4-triazol-1-yl)pyrimidin-2-amine.
| Compound Name | 4-(2,2,3,4,4,4-hexafluorobutoxy)-6-(1,2,4-triazol-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 87547698 |
| Molecular Formula | C10H8F6N6O |
| Molecular Weight | 342.20 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 4-(2,2,3,4,4,4-hexafluorobutoxy)-6-(1,2,4-triazol-1-yl)pyrimidin-2-amine |
| SMILES | Nc1nc(OCC(F)(F)C(F)C(F)(F)F)cc(-n2cncn2)n1 |
| InChI | InChI=1S/C10H8F6N6O/c11-7(10(14,15)16)9(12,13)2-23-6-1-5(20-8(17)21-6)22-4-18-3-19-22/h1,3-4,7H,2H2,(H2,17,20,21) |
| InChIKey | SCEIQBHLXFPMKU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.20 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |