C24H21Cl2N3O4S — CID 87547766
4-chloro-2-(5-chloro-2-hydroxyphenyl)sulfanylphenol;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 87547766) has the molecular formula C24H21Cl2N3O4S and a molecular weight of 518.42 g/mol. Its IUPAC name is 4-chloro-2-(5-chloro-2-hydroxyphenyl)sulfanylphenol;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 4-chloro-2-(5-chloro-2-hydroxyphenyl)sulfanylphenol;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 87547766 |
| Molecular Formula | C24H21Cl2N3O4S |
| Molecular Weight | 518.42 g/mol |
| Exact Mass | 517.06 |
| IUPAC Name | 4-chloro-2-(5-chloro-2-hydroxyphenyl)sulfanylphenol;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=C(N2CC2)C(=O)C(N2CC2)=C1N1CC1.Oc1ccc(Cl)cc1Sc1cc(Cl)ccc1O |
| InChI | InChI=1S/C12H8Cl2O2S.C12H13N3O2/c13-7-1-3-9(15)11(5-7)17-12-6-8(14)2-4-10(12)16;16-9-7-8(13-1-2-13)12(17)11(15-5-6-15)10(9)14-3-4-14/h1-6,15-16H;7H,1-6H2 |
| InChIKey | FHNICIJWDGZHMT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|