C11H9F6N5O2 — CID 87548021
2-(2,2,3,4,4,4-hexafluorobutoxy)-5-methoxy-4-(1,2,4-triazol-1-yl)pyrimidine (PubChem CID 87548021) has the molecular formula C11H9F6N5O2 and a molecular weight of 357.21 g/mol. Its IUPAC name is 2-(2,2,3,4,4,4-hexafluorobutoxy)-5-methoxy-4-(1,2,4-triazol-1-yl)pyrimidine.
| Compound Name | 2-(2,2,3,4,4,4-hexafluorobutoxy)-5-methoxy-4-(1,2,4-triazol-1-yl)pyrimidine |
|---|---|
| PubChem CID | 87548021 |
| Molecular Formula | C11H9F6N5O2 |
| Molecular Weight | 357.21 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 2-(2,2,3,4,4,4-hexafluorobutoxy)-5-methoxy-4-(1,2,4-triazol-1-yl)pyrimidine |
| SMILES | COc1cnc(OCC(F)(F)C(F)C(F)(F)F)nc1-n1cncn1 |
| InChI | InChI=1S/C11H9F6N5O2/c1-23-6-2-19-9(21-7(6)22-5-18-4-20-22)24-3-10(13,14)8(12)11(15,16)17/h2,4-5,8H,3H2,1H3 |
| InChIKey | XJWFZJPSODPJEG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 74.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.21 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |