C13H13F6NOS — CID 87548153
2-(2-ethyl-3,4-dihydro-2H-1,4-benzothiazin-7-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 87548153) has the molecular formula C13H13F6NOS and a molecular weight of 345.31 g/mol. Its IUPAC name is 2-(2-ethyl-3,4-dihydro-2H-1,4-benzothiazin-7-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(2-ethyl-3,4-dihydro-2H-1,4-benzothiazin-7-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 87548153 |
| Molecular Formula | C13H13F6NOS |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 2-(2-ethyl-3,4-dihydro-2H-1,4-benzothiazin-7-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCC1CNc2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2S1 |
| InChI | InChI=1S/C13H13F6NOS/c1-2-8-6-20-9-4-3-7(5-10(9)22-8)11(21,12(14,15)16)13(17,18)19/h3-5,8,20-21H,2,6H2,1H3 |
| InChIKey | DUVYCVJTLQFBDH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |