C12F18O — CID 87548397
1,1,2,3,3,4,4,6,6-nonafluoro-5-(1,1,3,3,4,4,5,6,6-nonafluorohexa-1,5-dien-2-yloxy)hexa-1,5-diene (PubChem CID 87548397) has the molecular formula C12F18O and a molecular weight of 502.10 g/mol. Its IUPAC name is 1,1,2,3,3,4,4,6,6-nonafluoro-5-(1,1,3,3,4,4,5,6,6-nonafluorohexa-1,5-dien-2-yloxy)hexa-1,5-diene.
| Compound Name | 1,1,2,3,3,4,4,6,6-nonafluoro-5-(1,1,3,3,4,4,5,6,6-nonafluorohexa-1,5-dien-2-yloxy)hexa-1,5-diene |
|---|---|
| PubChem CID | 87548397 |
| Molecular Formula | C12F18O |
| Molecular Weight | 502.10 g/mol |
| Exact Mass | 501.97 |
| IUPAC Name | 1,1,2,3,3,4,4,6,6-nonafluoro-5-(1,1,3,3,4,4,5,6,6-nonafluorohexa-1,5-dien-2-yloxy)hexa-1,5-diene |
| SMILES | FC(F)=C(F)C(F)(F)C(F)(F)C(OC(=C(F)F)C(F)(F)C(F)(F)C(F)=C(F)F)=C(F)F |
| InChI | InChI=1S/C12F18O/c13-1(5(15)16)9(23,24)11(27,28)3(7(19)20)31-4(8(21)22)12(29,30)10(25,26)2(14)6(17)18 |
| InChIKey | IMOXXVHIZFIHNG-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.10 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|