About 6-chloro-6-fluorocyclohexa-2,4-diene-1-sulfonyl chloride
6-chloro-6-fluorocyclohexa-2,4-diene-1-sulfonyl chloride (PubChem CID 87548713) has the molecular formula C6H5Cl2FO2S
and a molecular weight of 231.08 g/mol. Its IUPAC name is 6-chloro-6-fluorocyclohexa-2,4-diene-1-sulfonyl chloride.
Molecular Properties
| Compound Name | 6-chloro-6-fluorocyclohexa-2,4-diene-1-sulfonyl chloride |
| PubChem CID | 87548713 |
| Molecular Formula | C6H5Cl2FO2S |
| Molecular Weight | 231.08 g/mol |
| Exact Mass | 229.94 |
| IUPAC Name | 6-chloro-6-fluorocyclohexa-2,4-diene-1-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)C1C=CC=CC1(F)Cl |
| InChI | InChI=1S/C6H5Cl2FO2S/c7-6(9)4-2-1-3-5(6)12(8,10)11/h1-5H |
| InChIKey | NGPRAXPYFHIJTC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.08 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-6-fluorocyclohexa-2,4-diene-1-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-6-fluorocyclohexa-2,4-diene-1-sulfonyl chloride?
The IUPAC name of 6-chloro-6-fluorocyclohexa-2,4-diene-1-sulfonyl chloride (CID 87548713) is 6-chloro-6-fluorocyclohexa-2,4-diene-1-sulfonyl chloride.
What is the SMILES notation for 6-chloro-6-fluorocyclohexa-2,4-diene-1-sulfonyl chloride?
The canonical SMILES for 6-chloro-6-fluorocyclohexa-2,4-diene-1-sulfonyl chloride is O=S(=O)(Cl)C1C=CC=CC1(F)Cl.
What is the InChIKey of 6-chloro-6-fluorocyclohexa-2,4-diene-1-sulfonyl chloride?
The InChIKey is NGPRAXPYFHIJTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Cl2FO2S/c7-6(9)4-2-1-3-5(6)12(8,10)11/h1-5H.
What are the key properties of 6-chloro-6-fluorocyclohexa-2,4-diene-1-sulfonyl chloride?
6-chloro-6-fluorocyclohexa-2,4-diene-1-sulfonyl chloride has a molecular weight of 231.08 g/mol, XLogP of 1.95, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-6-fluorocyclohexa-2,4-diene-1-sulfonyl chloride is sourced from PubChem (CID 87548713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).