C20H32S — CID 87548832
(5R,7S,8S,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-7-carbothialdehyde (PubChem CID 87548832) has the molecular formula C20H32S and a molecular weight of 304.54 g/mol. Its IUPAC name is (5R,7S,8S,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-7-carbothialdehyde.
| Compound Name | (5R,7S,8S,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-7-carbothialdehyde |
|---|---|
| PubChem CID | 87548832 |
| Molecular Formula | C20H32S |
| Molecular Weight | 304.54 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | (5R,7S,8S,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-7-carbothialdehyde |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1[C@@H](C=S)C[C@H]3CCCC[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C20H32S/c1-19-9-5-7-16(19)18-14(13-21)12-15-6-3-4-10-20(15,2)17(18)8-11-19/h13-18H,3-12H2,1-2H3/t14-,15-,16+,17+,18+,19+,20+/m1/s1 |
| InChIKey | OYCHZHFMSMMDAC-PAPWGAKMSA-N |
| XLogP | 6.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.54 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|