About potassium;2-methylpropan-2-olate;methylsulfinylmethane
potassium;2-methylpropan-2-olate;methylsulfinylmethane (PubChem CID 87549036) has the molecular formula C6H15KO2S
and a molecular weight of 190.35 g/mol. Its IUPAC name is potassium;2-methylpropan-2-olate;methylsulfinylmethane.
Molecular Properties
| Compound Name | potassium;2-methylpropan-2-olate;methylsulfinylmethane |
| PubChem CID | 87549036 |
| Molecular Formula | C6H15KO2S |
| Molecular Weight | 190.35 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | potassium;2-methylpropan-2-olate;methylsulfinylmethane |
| SMILES | CC(C)(C)[O-].CS(C)=O.[K+] |
| InChI | InChI=1S/C4H9O.C2H6OS.K/c1-4(2,3)5;1-4(2)3;/h1-3H3;1-2H3;/q-1;;+1 |
| InChIKey | DAPIMSMZSXHIOD-UHFFFAOYSA-N |
| XLogP | -2.86 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.35 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze potassium;2-methylpropan-2-olate;methylsulfinylmethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;2-methylpropan-2-olate;methylsulfinylmethane?
The IUPAC name of potassium;2-methylpropan-2-olate;methylsulfinylmethane (CID 87549036) is potassium;2-methylpropan-2-olate;methylsulfinylmethane.
What is the SMILES notation for potassium;2-methylpropan-2-olate;methylsulfinylmethane?
The canonical SMILES for potassium;2-methylpropan-2-olate;methylsulfinylmethane is CC(C)(C)[O-].CS(C)=O.[K+].
What is the InChIKey of potassium;2-methylpropan-2-olate;methylsulfinylmethane?
The InChIKey is DAPIMSMZSXHIOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9O.C2H6OS.K/c1-4(2,3)5;1-4(2)3;/h1-3H3;1-2H3;/q-1;;+1.
What are the key properties of potassium;2-methylpropan-2-olate;methylsulfinylmethane?
potassium;2-methylpropan-2-olate;methylsulfinylmethane has a molecular weight of 190.35 g/mol, XLogP of -2.86, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;2-methylpropan-2-olate;methylsulfinylmethane is sourced from PubChem (CID 87549036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).