About 6-bromo-5,6-difluorocyclohexa-2,4-diene-1-carbaldehyde
6-bromo-5,6-difluorocyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 87549038) has the molecular formula C7H5BrF2O
and a molecular weight of 223.02 g/mol. Its IUPAC name is 6-bromo-5,6-difluorocyclohexa-2,4-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 6-bromo-5,6-difluorocyclohexa-2,4-diene-1-carbaldehyde |
| PubChem CID | 87549038 |
| Molecular Formula | C7H5BrF2O |
| Molecular Weight | 223.02 g/mol |
| Exact Mass | 221.95 |
| IUPAC Name | 6-bromo-5,6-difluorocyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | O=CC1C=CC=C(F)C1(F)Br |
| InChI | InChI=1S/C7H5BrF2O/c8-7(10)5(4-11)2-1-3-6(7)9/h1-5H |
| InChIKey | DKKDHFVRIHAPRG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.02 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-5,6-difluorocyclohexa-2,4-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-5,6-difluorocyclohexa-2,4-diene-1-carbaldehyde?
The IUPAC name of 6-bromo-5,6-difluorocyclohexa-2,4-diene-1-carbaldehyde (CID 87549038) is 6-bromo-5,6-difluorocyclohexa-2,4-diene-1-carbaldehyde.
What is the SMILES notation for 6-bromo-5,6-difluorocyclohexa-2,4-diene-1-carbaldehyde?
The canonical SMILES for 6-bromo-5,6-difluorocyclohexa-2,4-diene-1-carbaldehyde is O=CC1C=CC=C(F)C1(F)Br.
What is the InChIKey of 6-bromo-5,6-difluorocyclohexa-2,4-diene-1-carbaldehyde?
The InChIKey is DKKDHFVRIHAPRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrF2O/c8-7(10)5(4-11)2-1-3-6(7)9/h1-5H.
What are the key properties of 6-bromo-5,6-difluorocyclohexa-2,4-diene-1-carbaldehyde?
6-bromo-5,6-difluorocyclohexa-2,4-diene-1-carbaldehyde has a molecular weight of 223.02 g/mol, XLogP of 2.29, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-5,6-difluorocyclohexa-2,4-diene-1-carbaldehyde is sourced from PubChem (CID 87549038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).