C19H32OS — CID 87549788
(5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-17-sulfanyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 87549788) has the molecular formula C19H32OS and a molecular weight of 308.53 g/mol. Its IUPAC name is (5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-17-sulfanyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-17-sulfanyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 87549788 |
| Molecular Formula | C19H32OS |
| Molecular Weight | 308.53 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | (5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-17-sulfanyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@]12CCC(O)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](S)CC[C@@H]12 |
| InChI | InChI=1S/C19H32OS/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h12-17,20-21H,3-11H2,1-2H3/t12-,13?,14-,15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | ASPJDXVWKUWLON-DYSINSMMSA-N |
| XLogP | 4.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|