About methanamine;2-methylbutanamide
methanamine;2-methylbutanamide (PubChem CID 87550062) has the molecular formula C6H16N2O
and a molecular weight of 132.21 g/mol. Its IUPAC name is methanamine;2-methylbutanamide.
Molecular Properties
| Compound Name | methanamine;2-methylbutanamide |
| PubChem CID | 87550062 |
| Molecular Formula | C6H16N2O |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.13 |
| IUPAC Name | methanamine;2-methylbutanamide |
| SMILES | CCC(C)C(N)=O.CN |
| InChI | InChI=1S/C5H11NO.CH5N/c1-3-4(2)5(6)7;1-2/h4H,3H2,1-2H3,(H2,6,7);2H2,1H3 |
| InChIKey | DJHZQUYMMYWAFV-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methanamine;2-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;2-methylbutanamide?
The IUPAC name of methanamine;2-methylbutanamide (CID 87550062) is methanamine;2-methylbutanamide.
What is the SMILES notation for methanamine;2-methylbutanamide?
The canonical SMILES for methanamine;2-methylbutanamide is CCC(C)C(N)=O.CN.
What is the InChIKey of methanamine;2-methylbutanamide?
The InChIKey is DJHZQUYMMYWAFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO.CH5N/c1-3-4(2)5(6)7;1-2/h4H,3H2,1-2H3,(H2,6,7);2H2,1H3.
What are the key properties of methanamine;2-methylbutanamide?
methanamine;2-methylbutanamide has a molecular weight of 132.21 g/mol, XLogP of 0.09, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;2-methylbutanamide is sourced from PubChem (CID 87550062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).