C18H17F17N4O3S — CID 87550103
1-methylimidazole;1-methyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)imidazol-1-ium;1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 87550103) has the molecular formula C18H17F17N4O3S and a molecular weight of 692.39 g/mol. Its IUPAC name is 1-methylimidazole;1-methyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)imidazol-1-ium;1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | 1-methylimidazole;1-methyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)imidazol-1-ium;1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 87550103 |
| Molecular Formula | C18H17F17N4O3S |
| Molecular Weight | 692.39 g/mol |
| Exact Mass | 692.07 |
| IUPAC Name | 1-methylimidazole;1-methyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)imidazol-1-ium;1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | C[n+]1ccn(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1.Cn1ccnc1.O=S(=O)([O-])C(F)(F)C(F)F |
| InChI | InChI=1S/C12H10F13N2.C4H6N2.C2H2F4O3S/c1-26-4-5-27(6-26)3-2-7(13,14)8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)25;1-6-3-2-5-4-6;3-1(4)2(5,6)10(7,8)9/h4-6H,2-3H2,1H3;2-4H,1H3;1H,(H,7,8,9)/q+1;;/p-1 |
| InChIKey | XTYLHNKJBJAJNP-UHFFFAOYSA-M |
| XLogP | 5.25 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.39 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|