About 2,6-ditert-butyl-4-(5-cyclohexyl-2-methylsulfanyl-1,3-thiazol-4-yl)phenol
2,6-ditert-butyl-4-(5-cyclohexyl-2-methylsulfanyl-1,3-thiazol-4-yl)phenol (PubChem CID 87550363) has the molecular formula C24H35NOS2
and a molecular weight of 417.68 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(5-cyclohexyl-2-methylsulfanyl-1,3-thiazol-4-yl)phenol.
Molecular Properties
| Compound Name | 2,6-ditert-butyl-4-(5-cyclohexyl-2-methylsulfanyl-1,3-thiazol-4-yl)phenol |
| PubChem CID | 87550363 |
| Molecular Formula | C24H35NOS2 |
| Molecular Weight | 417.68 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 2,6-ditert-butyl-4-(5-cyclohexyl-2-methylsulfanyl-1,3-thiazol-4-yl)phenol |
| SMILES | CSc1nc(-c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c(C2CCCCC2)s1 |
| InChI | InChI=1S/C24H35NOS2/c1-23(2,3)17-13-16(14-18(20(17)26)24(4,5)6)19-21(28-22(25-19)27-7)15-11-9-8-10-12-15/h13-15,26H,8-12H2,1-7H3 |
| InChIKey | TYQCVUCESNNYJW-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.68 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,6-ditert-butyl-4-(5-cyclohexyl-2-methylsulfanyl-1,3-thiazol-4-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-ditert-butyl-4-(5-cyclohexyl-2-methylsulfanyl-1,3-thiazol-4-yl)phenol?
The IUPAC name of 2,6-ditert-butyl-4-(5-cyclohexyl-2-methylsulfanyl-1,3-thiazol-4-yl)phenol (CID 87550363) is 2,6-ditert-butyl-4-(5-cyclohexyl-2-methylsulfanyl-1,3-thiazol-4-yl)phenol.
What is the SMILES notation for 2,6-ditert-butyl-4-(5-cyclohexyl-2-methylsulfanyl-1,3-thiazol-4-yl)phenol?
The canonical SMILES for 2,6-ditert-butyl-4-(5-cyclohexyl-2-methylsulfanyl-1,3-thiazol-4-yl)phenol is CSc1nc(-c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c(C2CCCCC2)s1.
What is the InChIKey of 2,6-ditert-butyl-4-(5-cyclohexyl-2-methylsulfanyl-1,3-thiazol-4-yl)phenol?
The InChIKey is TYQCVUCESNNYJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H35NOS2/c1-23(2,3)17-13-16(14-18(20(17)26)24(4,5)6)19-21(28-22(25-19)27-7)15-11-9-8-10-12-15/h13-15,26H,8-12H2,1-7H3.
What are the key properties of 2,6-ditert-butyl-4-(5-cyclohexyl-2-methylsulfanyl-1,3-thiazol-4-yl)phenol?
2,6-ditert-butyl-4-(5-cyclohexyl-2-methylsulfanyl-1,3-thiazol-4-yl)phenol has a molecular weight of 417.68 g/mol, XLogP of 7.88, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-ditert-butyl-4-(5-cyclohexyl-2-methylsulfanyl-1,3-thiazol-4-yl)phenol is sourced from PubChem (CID 87550363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).