C26H27FN2O2S — CID 87550407
3-[1-[4-(2,4-dimethyl-1,3-thiazol-5-yl)phenyl]ethyl]-6-(4-fluorophenyl)-6-prop-2-enyl-1,3-oxazinan-2-one (PubChem CID 87550407) has the molecular formula C26H27FN2O2S and a molecular weight of 450.58 g/mol. Its IUPAC name is 3-[1-[4-(2,4-dimethyl-1,3-thiazol-5-yl)phenyl]ethyl]-6-(4-fluorophenyl)-6-prop-2-enyl-1,3-oxazinan-2-one.
| Compound Name | 3-[1-[4-(2,4-dimethyl-1,3-thiazol-5-yl)phenyl]ethyl]-6-(4-fluorophenyl)-6-prop-2-enyl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 87550407 |
| Molecular Formula | C26H27FN2O2S |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 3-[1-[4-(2,4-dimethyl-1,3-thiazol-5-yl)phenyl]ethyl]-6-(4-fluorophenyl)-6-prop-2-enyl-1,3-oxazinan-2-one |
| SMILES | C=CCC1(c2ccc(F)cc2)CCN(C(C)c2ccc(-c3sc(C)nc3C)cc2)C(=O)O1 |
| InChI | InChI=1S/C26H27FN2O2S/c1-5-14-26(22-10-12-23(27)13-11-22)15-16-29(25(30)31-26)18(3)20-6-8-21(9-7-20)24-17(2)28-19(4)32-24/h5-13,18H,1,14-16H2,2-4H3 |
| InChIKey | UWMSFLKZKPLFMH-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|