About 1-phenyl-1,2-bis(trifluoromethyl)hydrazine
1-phenyl-1,2-bis(trifluoromethyl)hydrazine (PubChem CID 87550467) has the molecular formula C8H6F6N2
and a molecular weight of 244.14 g/mol. Its IUPAC name is 1-phenyl-1,2-bis(trifluoromethyl)hydrazine.
Molecular Properties
| Compound Name | 1-phenyl-1,2-bis(trifluoromethyl)hydrazine |
| PubChem CID | 87550467 |
| Molecular Formula | C8H6F6N2 |
| Molecular Weight | 244.14 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 1-phenyl-1,2-bis(trifluoromethyl)hydrazine |
| SMILES | FC(F)(F)NN(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C8H6F6N2/c9-7(10,11)15-16(8(12,13)14)6-4-2-1-3-5-6/h1-5,15H |
| InChIKey | BMPMSIKWEHDUFM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.14 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-1,2-bis(trifluoromethyl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-1,2-bis(trifluoromethyl)hydrazine?
The IUPAC name of 1-phenyl-1,2-bis(trifluoromethyl)hydrazine (CID 87550467) is 1-phenyl-1,2-bis(trifluoromethyl)hydrazine.
What is the SMILES notation for 1-phenyl-1,2-bis(trifluoromethyl)hydrazine?
The canonical SMILES for 1-phenyl-1,2-bis(trifluoromethyl)hydrazine is FC(F)(F)NN(c1ccccc1)C(F)(F)F.
What is the InChIKey of 1-phenyl-1,2-bis(trifluoromethyl)hydrazine?
The InChIKey is BMPMSIKWEHDUFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F6N2/c9-7(10,11)15-16(8(12,13)14)6-4-2-1-3-5-6/h1-5,15H.
What are the key properties of 1-phenyl-1,2-bis(trifluoromethyl)hydrazine?
1-phenyl-1,2-bis(trifluoromethyl)hydrazine has a molecular weight of 244.14 g/mol, XLogP of 3.04, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-1,2-bis(trifluoromethyl)hydrazine is sourced from PubChem (CID 87550467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).