About N'-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]methanediimine
N'-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]methanediimine (PubChem CID 87550676) has the molecular formula C7H12N2O2
and a molecular weight of 156.18 g/mol. Its IUPAC name is N'-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]methanediimine.
Molecular Properties
| Compound Name | N'-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]methanediimine |
| PubChem CID | 87550676 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | N'-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]methanediimine |
| SMILES | CC1(C)OCC(CN=C=N)O1 |
| InChI | InChI=1S/C7H12N2O2/c1-7(2)10-4-6(11-7)3-9-5-8/h6,8H,3-4H2,1-2H3 |
| InChIKey | JFWYBMBFRUQYPX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 54.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N'-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]methanediimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]methanediimine?
The IUPAC name of N'-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]methanediimine (CID 87550676) is N'-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]methanediimine.
What is the SMILES notation for N'-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]methanediimine?
The canonical SMILES for N'-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]methanediimine is CC1(C)OCC(CN=C=N)O1.
What is the InChIKey of N'-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]methanediimine?
The InChIKey is JFWYBMBFRUQYPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2/c1-7(2)10-4-6(11-7)3-9-5-8/h6,8H,3-4H2,1-2H3.
What are the key properties of N'-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]methanediimine?
N'-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]methanediimine has a molecular weight of 156.18 g/mol, XLogP of 0.89, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]methanediimine is sourced from PubChem (CID 87550676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).