C16H16Cl2N2O — CID 87550829
1-[4-[(2,5-dichloro-3-pyridinyl)methylamino]phenyl]butan-1-one (PubChem CID 87550829) has the molecular formula C16H16Cl2N2O and a molecular weight of 323.22 g/mol. Its IUPAC name is 1-[4-[(2,5-dichloro-3-pyridinyl)methylamino]phenyl]butan-1-one.
| Compound Name | 1-[4-[(2,5-dichloro-3-pyridinyl)methylamino]phenyl]butan-1-one |
|---|---|
| PubChem CID | 87550829 |
| Molecular Formula | C16H16Cl2N2O |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 1-[4-[(2,5-dichloro-3-pyridinyl)methylamino]phenyl]butan-1-one |
| SMILES | CCCC(=O)c1ccc(NCc2cc(Cl)cnc2Cl)cc1 |
| InChI | InChI=1S/C16H16Cl2N2O/c1-2-3-15(21)11-4-6-14(7-5-11)19-9-12-8-13(17)10-20-16(12)18/h4-8,10,19H,2-3,9H2,1H3 |
| InChIKey | HFFZFPHARIVNKD-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|