About 5-chloro-1,3-bis(prop-2-enyl)pyrazole-4-carbonyl fluoride
5-chloro-1,3-bis(prop-2-enyl)pyrazole-4-carbonyl fluoride (PubChem CID 87550984) has the molecular formula C10H10ClFN2O
and a molecular weight of 228.65 g/mol. Its IUPAC name is 5-chloro-1,3-bis(prop-2-enyl)pyrazole-4-carbonyl fluoride.
Molecular Properties
| Compound Name | 5-chloro-1,3-bis(prop-2-enyl)pyrazole-4-carbonyl fluoride |
| PubChem CID | 87550984 |
| Molecular Formula | C10H10ClFN2O |
| Molecular Weight | 228.65 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 5-chloro-1,3-bis(prop-2-enyl)pyrazole-4-carbonyl fluoride |
| SMILES | C=CCc1nn(CC=C)c(Cl)c1C(=O)F |
| InChI | InChI=1S/C10H10ClFN2O/c1-3-5-7-8(10(12)15)9(11)14(13-7)6-4-2/h3-4H,1-2,5-6H2 |
| InChIKey | HGAXLINPWHQAJP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.65 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-1,3-bis(prop-2-enyl)pyrazole-4-carbonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1,3-bis(prop-2-enyl)pyrazole-4-carbonyl fluoride?
The IUPAC name of 5-chloro-1,3-bis(prop-2-enyl)pyrazole-4-carbonyl fluoride (CID 87550984) is 5-chloro-1,3-bis(prop-2-enyl)pyrazole-4-carbonyl fluoride.
What is the SMILES notation for 5-chloro-1,3-bis(prop-2-enyl)pyrazole-4-carbonyl fluoride?
The canonical SMILES for 5-chloro-1,3-bis(prop-2-enyl)pyrazole-4-carbonyl fluoride is C=CCc1nn(CC=C)c(Cl)c1C(=O)F.
What is the InChIKey of 5-chloro-1,3-bis(prop-2-enyl)pyrazole-4-carbonyl fluoride?
The InChIKey is HGAXLINPWHQAJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClFN2O/c1-3-5-7-8(10(12)15)9(11)14(13-7)6-4-2/h3-4H,1-2,5-6H2.
What are the key properties of 5-chloro-1,3-bis(prop-2-enyl)pyrazole-4-carbonyl fluoride?
5-chloro-1,3-bis(prop-2-enyl)pyrazole-4-carbonyl fluoride has a molecular weight of 228.65 g/mol, XLogP of 2.56, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1,3-bis(prop-2-enyl)pyrazole-4-carbonyl fluoride is sourced from PubChem (CID 87550984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).