C11H27NO4P+ — CID 87551003
trimethyl(2-phosphonooxyoctyl)azanium (PubChem CID 87551003) has the molecular formula C11H27NO4P+ and a molecular weight of 268.31 g/mol. Its IUPAC name is trimethyl(2-phosphonooxyoctyl)azanium.
| Compound Name | trimethyl(2-phosphonooxyoctyl)azanium |
|---|---|
| PubChem CID | 87551003 |
| Molecular Formula | C11H27NO4P+ |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | trimethyl(2-phosphonooxyoctyl)azanium |
| SMILES | CCCCCCC(C[N+](C)(C)C)OP(=O)(O)O |
| InChI | InChI=1S/C11H26NO4P/c1-5-6-7-8-9-11(10-12(2,3)4)16-17(13,14)15/h11H,5-10H2,1-4H3,(H-,13,14,15)/p+1 |
| InChIKey | RSYCBNDMPGVSEE-UHFFFAOYSA-O |
| XLogP | 2.14 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|