About N-[6-(butanoylamino)-3,5,5-trimethylhexyl]butanamide
N-[6-(butanoylamino)-3,5,5-trimethylhexyl]butanamide (PubChem CID 87551370) has the molecular formula C17H34N2O2
and a molecular weight of 298.47 g/mol. Its IUPAC name is N-[6-(butanoylamino)-3,5,5-trimethylhexyl]butanamide.
Molecular Properties
| Compound Name | N-[6-(butanoylamino)-3,5,5-trimethylhexyl]butanamide |
| PubChem CID | 87551370 |
| Molecular Formula | C17H34N2O2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.26 |
| IUPAC Name | N-[6-(butanoylamino)-3,5,5-trimethylhexyl]butanamide |
| SMILES | CCCC(=O)NCCC(C)CC(C)(C)CNC(=O)CCC |
| InChI | InChI=1S/C17H34N2O2/c1-6-8-15(20)18-11-10-14(3)12-17(4,5)13-19-16(21)9-7-2/h14H,6-13H2,1-5H3,(H,18,20)(H,19,21) |
| InChIKey | CWNFSIRTPFZEGF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[6-(butanoylamino)-3,5,5-trimethylhexyl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(butanoylamino)-3,5,5-trimethylhexyl]butanamide?
The IUPAC name of N-[6-(butanoylamino)-3,5,5-trimethylhexyl]butanamide (CID 87551370) is N-[6-(butanoylamino)-3,5,5-trimethylhexyl]butanamide.
What is the SMILES notation for N-[6-(butanoylamino)-3,5,5-trimethylhexyl]butanamide?
The canonical SMILES for N-[6-(butanoylamino)-3,5,5-trimethylhexyl]butanamide is CCCC(=O)NCCC(C)CC(C)(C)CNC(=O)CCC.
What is the InChIKey of N-[6-(butanoylamino)-3,5,5-trimethylhexyl]butanamide?
The InChIKey is CWNFSIRTPFZEGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34N2O2/c1-6-8-15(20)18-11-10-14(3)12-17(4,5)13-19-16(21)9-7-2/h14H,6-13H2,1-5H3,(H,18,20)(H,19,21).
What are the key properties of N-[6-(butanoylamino)-3,5,5-trimethylhexyl]butanamide?
N-[6-(butanoylamino)-3,5,5-trimethylhexyl]butanamide has a molecular weight of 298.47 g/mol, XLogP of 3.26, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(butanoylamino)-3,5,5-trimethylhexyl]butanamide is sourced from PubChem (CID 87551370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).