About ethyl 2-hydroxypropanoate;propan-2-one
ethyl 2-hydroxypropanoate;propan-2-one (PubChem CID 87551470) has the molecular formula C8H16O4
and a molecular weight of 176.21 g/mol. Its IUPAC name is ethyl 2-hydroxypropanoate;propan-2-one.
Molecular Properties
| Compound Name | ethyl 2-hydroxypropanoate;propan-2-one |
| PubChem CID | 87551470 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | ethyl 2-hydroxypropanoate;propan-2-one |
| SMILES | CC(C)=O.CCOC(=O)C(C)O |
| InChI | InChI=1S/C5H10O3.C3H6O/c1-3-8-5(7)4(2)6;1-3(2)4/h4,6H,3H2,1-2H3;1-2H3 |
| InChIKey | RKXKBPTWFPNOBJ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-hydroxypropanoate;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-hydroxypropanoate;propan-2-one?
The IUPAC name of ethyl 2-hydroxypropanoate;propan-2-one (CID 87551470) is ethyl 2-hydroxypropanoate;propan-2-one.
What is the SMILES notation for ethyl 2-hydroxypropanoate;propan-2-one?
The canonical SMILES for ethyl 2-hydroxypropanoate;propan-2-one is CC(C)=O.CCOC(=O)C(C)O.
What is the InChIKey of ethyl 2-hydroxypropanoate;propan-2-one?
The InChIKey is RKXKBPTWFPNOBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3.C3H6O/c1-3-8-5(7)4(2)6;1-3(2)4/h4,6H,3H2,1-2H3;1-2H3.
What are the key properties of ethyl 2-hydroxypropanoate;propan-2-one?
ethyl 2-hydroxypropanoate;propan-2-one has a molecular weight of 176.21 g/mol, XLogP of 0.53, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-hydroxypropanoate;propan-2-one is sourced from PubChem (CID 87551470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).