C16H15FIN3O3 — CID 87552135
6-[(3-fluorophenyl)methoxy]-N-[1-(iodoamino)-1-oxopropan-2-yl]pyridine-3-carboxamide (PubChem CID 87552135) has the molecular formula C16H15FIN3O3 and a molecular weight of 443.22 g/mol. Its IUPAC name is 6-[(3-fluorophenyl)methoxy]-N-[1-(iodoamino)-1-oxopropan-2-yl]pyridine-3-carboxamide.
| Compound Name | 6-[(3-fluorophenyl)methoxy]-N-[1-(iodoamino)-1-oxopropan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87552135 |
| Molecular Formula | C16H15FIN3O3 |
| Molecular Weight | 443.22 g/mol |
| Exact Mass | 443.01 |
| IUPAC Name | 6-[(3-fluorophenyl)methoxy]-N-[1-(iodoamino)-1-oxopropan-2-yl]pyridine-3-carboxamide |
| SMILES | CC(NC(=O)c1ccc(OCc2cccc(F)c2)nc1)C(=O)NI |
| InChI | InChI=1S/C16H15FIN3O3/c1-10(15(22)21-18)20-16(23)12-5-6-14(19-8-12)24-9-11-3-2-4-13(17)7-11/h2-8,10H,9H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | BURZGOVOODGPEM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.22 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|