C70H38F30O12S6+2 — CID 87552238
bis(bis[4-[3,5-bis(trifluoromethyl)phenyl]sulfonyloxyphenyl]-phenylsulfanium);1,1,1,2,2,2-hexafluoroethane (PubChem CID 87552238) has the molecular formula C70H38F30O12S6+2 and a molecular weight of 1833.40 g/mol. Its IUPAC name is bis(bis[4-[3,5-bis(trifluoromethyl)phenyl]sulfonyloxyphenyl]-phenylsulfanium);1,1,1,2,2,2-hexafluoroethane.
| Compound Name | bis(bis[4-[3,5-bis(trifluoromethyl)phenyl]sulfonyloxyphenyl]-phenylsulfanium);1,1,1,2,2,2-hexafluoroethane |
|---|---|
| PubChem CID | 87552238 |
| Molecular Formula | C70H38F30O12S6+2 |
| Molecular Weight | 1833.40 g/mol |
| Exact Mass | 1832.02 |
| IUPAC Name | bis(bis[4-[3,5-bis(trifluoromethyl)phenyl]sulfonyloxyphenyl]-phenylsulfanium);1,1,1,2,2,2-hexafluoroethane |
| SMILES | FC(F)(F)C(F)(F)F.O=S(=O)(Oc1ccc([S+](c2ccccc2)c2ccc(OS(=O)(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)cc2)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.O=S(=O)(Oc1ccc([S+](c2ccccc2)c2ccc(OS(=O)(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)cc2)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/2C34H19F12O6S3.C2F6/c2*35-31(36,37)20-14-21(32(38,39)40)17-29(16-20)54(47,48)51-24-6-10-27(11-7-24)53(26-4-2-1-3-5-26)28-12-8-25(9-13-28)52-55(49,50)30-18-22(33(41,42)43)15-23(19-30)34(44,45)46;3-1(4,5)2(6,7)8/h2*1-19H;/q2*+1; |
| InChIKey | YUMZYQCXQGUOKN-UHFFFAOYSA-N |
| XLogP | 22.90 |
| TPSA | 173.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 118 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1833.40 |
| LogP ≤ 5 | 22.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|