About (3-methylphenyl)sulfanyl propanimidothioate
(3-methylphenyl)sulfanyl propanimidothioate (PubChem CID 87552380) has the molecular formula C10H13NS2
and a molecular weight of 211.35 g/mol. Its IUPAC name is (3-methylphenyl)sulfanyl propanimidothioate.
Molecular Properties
| Compound Name | (3-methylphenyl)sulfanyl propanimidothioate |
| PubChem CID | 87552380 |
| Molecular Formula | C10H13NS2 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | (3-methylphenyl)sulfanyl propanimidothioate |
| SMILES | [H]/N=C(\CC)SSc1cccc(C)c1 |
| InChI | InChI=1S/C10H13NS2/c1-3-10(11)13-12-9-6-4-5-8(2)7-9/h4-7,11H,3H2,1-2H3/b11-10+ |
| InChIKey | GRJWQVCJBZJGCH-ZHACJKMWSA-N |
| XLogP | 4.12 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (3-methylphenyl)sulfanyl propanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylphenyl)sulfanyl propanimidothioate?
The IUPAC name of (3-methylphenyl)sulfanyl propanimidothioate (CID 87552380) is (3-methylphenyl)sulfanyl propanimidothioate.
What is the SMILES notation for (3-methylphenyl)sulfanyl propanimidothioate?
The canonical SMILES for (3-methylphenyl)sulfanyl propanimidothioate is [H]/N=C(\CC)SSc1cccc(C)c1.
What is the InChIKey of (3-methylphenyl)sulfanyl propanimidothioate?
The InChIKey is GRJWQVCJBZJGCH-ZHACJKMWSA-N. The full InChI is InChI=1S/C10H13NS2/c1-3-10(11)13-12-9-6-4-5-8(2)7-9/h4-7,11H,3H2,1-2H3/b11-10+.
What are the key properties of (3-methylphenyl)sulfanyl propanimidothioate?
(3-methylphenyl)sulfanyl propanimidothioate has a molecular weight of 211.35 g/mol, XLogP of 4.12, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylphenyl)sulfanyl propanimidothioate is sourced from PubChem (CID 87552380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).