C9H9F9O2 — CID 87552949
2-[(Z)-4,4,5,5,6,6,7,7,7-nonafluorohept-2-enoxy]ethanol (PubChem CID 87552949) has the molecular formula C9H9F9O2 and a molecular weight of 320.15 g/mol. Its IUPAC name is 2-[(Z)-4,4,5,5,6,6,7,7,7-nonafluorohept-2-enoxy]ethanol.
| Compound Name | 2-[(Z)-4,4,5,5,6,6,7,7,7-nonafluorohept-2-enoxy]ethanol |
|---|---|
| PubChem CID | 87552949 |
| Molecular Formula | C9H9F9O2 |
| Molecular Weight | 320.15 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 2-[(Z)-4,4,5,5,6,6,7,7,7-nonafluorohept-2-enoxy]ethanol |
| SMILES | OCCOC/C=C\C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H9F9O2/c10-6(11,2-1-4-20-5-3-19)7(12,13)8(14,15)9(16,17)18/h1-2,19H,3-5H2/b2-1- |
| InChIKey | LKKLYIHWEWOCGJ-UPHRSURJSA-N |
| XLogP | 3.02 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.15 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|