About [(3S,4R)-4-(4-fluorophenyl)-3-methylpiperidin-3-yl]methyl methanesulfonate
[(3S,4R)-4-(4-fluorophenyl)-3-methylpiperidin-3-yl]methyl methanesulfonate (PubChem CID 87553549) has the molecular formula C14H20FNO3S
and a molecular weight of 301.38 g/mol. Its IUPAC name is [(3S,4R)-4-(4-fluorophenyl)-3-methylpiperidin-3-yl]methyl methanesulfonate.
Molecular Properties
| Compound Name | [(3S,4R)-4-(4-fluorophenyl)-3-methylpiperidin-3-yl]methyl methanesulfonate |
| PubChem CID | 87553549 |
| Molecular Formula | C14H20FNO3S |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | [(3S,4R)-4-(4-fluorophenyl)-3-methylpiperidin-3-yl]methyl methanesulfonate |
| SMILES | C[C@@]1(COS(C)(=O)=O)CNCC[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C14H20FNO3S/c1-14(10-19-20(2,17)18)9-16-8-7-13(14)11-3-5-12(15)6-4-11/h3-6,13,16H,7-10H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | GAPQVFKDHCWJBD-KGLIPLIRSA-N |
| XLogP | 1.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(3S,4R)-4-(4-fluorophenyl)-3-methylpiperidin-3-yl]methyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4R)-4-(4-fluorophenyl)-3-methylpiperidin-3-yl]methyl methanesulfonate?
The IUPAC name of [(3S,4R)-4-(4-fluorophenyl)-3-methylpiperidin-3-yl]methyl methanesulfonate (CID 87553549) is [(3S,4R)-4-(4-fluorophenyl)-3-methylpiperidin-3-yl]methyl methanesulfonate.
What is the SMILES notation for [(3S,4R)-4-(4-fluorophenyl)-3-methylpiperidin-3-yl]methyl methanesulfonate?
The canonical SMILES for [(3S,4R)-4-(4-fluorophenyl)-3-methylpiperidin-3-yl]methyl methanesulfonate is C[C@@]1(COS(C)(=O)=O)CNCC[C@@H]1c1ccc(F)cc1.
What is the InChIKey of [(3S,4R)-4-(4-fluorophenyl)-3-methylpiperidin-3-yl]methyl methanesulfonate?
The InChIKey is GAPQVFKDHCWJBD-KGLIPLIRSA-N. The full InChI is InChI=1S/C14H20FNO3S/c1-14(10-19-20(2,17)18)9-16-8-7-13(14)11-3-5-12(15)6-4-11/h3-6,13,16H,7-10H2,1-2H3/t13-,14+/m1/s1.
What are the key properties of [(3S,4R)-4-(4-fluorophenyl)-3-methylpiperidin-3-yl]methyl methanesulfonate?
[(3S,4R)-4-(4-fluorophenyl)-3-methylpiperidin-3-yl]methyl methanesulfonate has a molecular weight of 301.38 g/mol, XLogP of 1.89, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4R)-4-(4-fluorophenyl)-3-methylpiperidin-3-yl]methyl methanesulfonate is sourced from PubChem (CID 87553549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).