C21H19F3N2O3 — CID 8755382
(2S)-2-[[(R)-furan-2-yl(phenyl)methyl]amino]-N-[4-(trifluoromethoxy)phenyl]propanamide (PubChem CID 8755382) has the molecular formula C21H19F3N2O3 and a molecular weight of 404.39 g/mol. Its IUPAC name is (2S)-2-[[(R)-furan-2-yl(phenyl)methyl]amino]-N-[4-(trifluoromethoxy)phenyl]propanamide.
| Compound Name | (2S)-2-[[(R)-furan-2-yl(phenyl)methyl]amino]-N-[4-(trifluoromethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 8755382 |
| Molecular Formula | C21H19F3N2O3 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | (2S)-2-[[(R)-furan-2-yl(phenyl)methyl]amino]-N-[4-(trifluoromethoxy)phenyl]propanamide |
| SMILES | C[C@H](N[C@H](c1ccccc1)c1ccco1)C(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H19F3N2O3/c1-14(20(27)26-16-9-11-17(12-10-16)29-21(22,23)24)25-19(18-8-5-13-28-18)15-6-3-2-4-7-15/h2-14,19,25H,1H3,(H,26,27)/t14-,19+/m0/s1 |
| InChIKey | HVJJRSVFOHSKGK-IFXJQAMLSA-N |
| XLogP | 4.88 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |