C22H20ClN3O — CID 87554292
4-[[4-(2-chloro-9H-pyrido[2,3-b]indol-6-yl)phenyl]methyl]morpholine (PubChem CID 87554292) has the molecular formula C22H20ClN3O and a molecular weight of 377.88 g/mol. Its IUPAC name is 4-[[4-(2-chloro-9H-pyrido[2,3-b]indol-6-yl)phenyl]methyl]morpholine.
| Compound Name | 4-[[4-(2-chloro-9H-pyrido[2,3-b]indol-6-yl)phenyl]methyl]morpholine |
|---|---|
| PubChem CID | 87554292 |
| Molecular Formula | C22H20ClN3O |
| Molecular Weight | 377.88 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 4-[[4-(2-chloro-9H-pyrido[2,3-b]indol-6-yl)phenyl]methyl]morpholine |
| SMILES | Clc1ccc2c(n1)[nH]c1ccc(-c3ccc(CN4CCOCC4)cc3)cc12 |
| InChI | InChI=1S/C22H20ClN3O/c23-21-8-6-18-19-13-17(5-7-20(19)24-22(18)25-21)16-3-1-15(2-4-16)14-26-9-11-27-12-10-26/h1-8,13H,9-12,14H2,(H,24,25) |
| InChIKey | QFBFRNKWBPIFBO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.88 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|