About 1-(2-chloro-9H-pyrido[2,3-b]indol-6-yl)-2-[1-(diethylamino)ethylsulfanyl]ethanone
1-(2-chloro-9H-pyrido[2,3-b]indol-6-yl)-2-[1-(diethylamino)ethylsulfanyl]ethanone (PubChem CID 87554665) has the molecular formula C19H22ClN3OS
and a molecular weight of 375.93 g/mol. Its IUPAC name is 1-(2-chloro-9H-pyrido[2,3-b]indol-6-yl)-2-[1-(diethylamino)ethylsulfanyl]ethanone.
Molecular Properties
| Compound Name | 1-(2-chloro-9H-pyrido[2,3-b]indol-6-yl)-2-[1-(diethylamino)ethylsulfanyl]ethanone |
| PubChem CID | 87554665 |
| Molecular Formula | C19H22ClN3OS |
| Molecular Weight | 375.93 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 1-(2-chloro-9H-pyrido[2,3-b]indol-6-yl)-2-[1-(diethylamino)ethylsulfanyl]ethanone |
| SMILES | CCN(CC)C(C)SCC(=O)c1ccc2[nH]c3nc(Cl)ccc3c2c1 |
| InChI | InChI=1S/C19H22ClN3OS/c1-4-23(5-2)12(3)25-11-17(24)13-6-8-16-15(10-13)14-7-9-18(20)22-19(14)21-16/h6-10,12H,4-5,11H2,1-3H3,(H,21,22) |
| InChIKey | HPRAXMBEQMPPMF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.93 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-chloro-9H-pyrido[2,3-b]indol-6-yl)-2-[1-(diethylamino)ethylsulfanyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chloro-9H-pyrido[2,3-b]indol-6-yl)-2-[1-(diethylamino)ethylsulfanyl]ethanone?
The IUPAC name of 1-(2-chloro-9H-pyrido[2,3-b]indol-6-yl)-2-[1-(diethylamino)ethylsulfanyl]ethanone (CID 87554665) is 1-(2-chloro-9H-pyrido[2,3-b]indol-6-yl)-2-[1-(diethylamino)ethylsulfanyl]ethanone.
What is the SMILES notation for 1-(2-chloro-9H-pyrido[2,3-b]indol-6-yl)-2-[1-(diethylamino)ethylsulfanyl]ethanone?
The canonical SMILES for 1-(2-chloro-9H-pyrido[2,3-b]indol-6-yl)-2-[1-(diethylamino)ethylsulfanyl]ethanone is CCN(CC)C(C)SCC(=O)c1ccc2[nH]c3nc(Cl)ccc3c2c1.
What is the InChIKey of 1-(2-chloro-9H-pyrido[2,3-b]indol-6-yl)-2-[1-(diethylamino)ethylsulfanyl]ethanone?
The InChIKey is HPRAXMBEQMPPMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22ClN3OS/c1-4-23(5-2)12(3)25-11-17(24)13-6-8-16-15(10-13)14-7-9-18(20)22-19(14)21-16/h6-10,12H,4-5,11H2,1-3H3,(H,21,22).
What are the key properties of 1-(2-chloro-9H-pyrido[2,3-b]indol-6-yl)-2-[1-(diethylamino)ethylsulfanyl]ethanone?
1-(2-chloro-9H-pyrido[2,3-b]indol-6-yl)-2-[1-(diethylamino)ethylsulfanyl]ethanone has a molecular weight of 375.93 g/mol, XLogP of 4.97, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chloro-9H-pyrido[2,3-b]indol-6-yl)-2-[1-(diethylamino)ethylsulfanyl]ethanone is sourced from PubChem (CID 87554665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).